C15H24N4O4 — CID 143049317
4-[(6-amino-4-morpholin-4-yl-2-pyridinyl)oxy]-N-(2-hydroxyethyl)butanamide (PubChem CID 143049317) has the molecular formula C15H24N4O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-[(6-amino-4-morpholin-4-yl-2-pyridinyl)oxy]-N-(2-hydroxyethyl)butanamide.
| Compound Name | 4-[(6-amino-4-morpholin-4-yl-2-pyridinyl)oxy]-N-(2-hydroxyethyl)butanamide |
|---|---|
| PubChem CID | 143049317 |
| Molecular Formula | C15H24N4O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 4-[(6-amino-4-morpholin-4-yl-2-pyridinyl)oxy]-N-(2-hydroxyethyl)butanamide |
| SMILES | Nc1cc(N2CCOCC2)cc(OCCCC(=O)NCCO)n1 |
| InChI | InChI=1S/C15H24N4O4/c16-13-10-12(19-4-8-22-9-5-19)11-15(18-13)23-7-1-2-14(21)17-3-6-20/h10-11,20H,1-9H2,(H2,16,18)(H,17,21) |
| InChIKey | QUZYQXANAZICJS-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|