C17H26N4O2 — CID 143049434
6-[2-(cyclohexylideneamino)ethoxy]-4-morpholin-4-ylpyridin-2-amine (PubChem CID 143049434) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 6-[2-(cyclohexylideneamino)ethoxy]-4-morpholin-4-ylpyridin-2-amine.
| Compound Name | 6-[2-(cyclohexylideneamino)ethoxy]-4-morpholin-4-ylpyridin-2-amine |
|---|---|
| PubChem CID | 143049434 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 6-[2-(cyclohexylideneamino)ethoxy]-4-morpholin-4-ylpyridin-2-amine |
| SMILES | Nc1cc(N2CCOCC2)cc(OCCN=C2CCCCC2)n1 |
| InChI | InChI=1S/C17H26N4O2/c18-16-12-15(21-7-10-22-11-8-21)13-17(20-16)23-9-6-19-14-4-2-1-3-5-14/h12-13H,1-11H2,(H2,18,20) |
| InChIKey | UHXDBYWSLHLDRY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|