C23H31N7O3 — CID 143049410
2H-indazol-3-ylmethanimine;4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-2-amine (PubChem CID 143049410) has the molecular formula C23H31N7O3 and a molecular weight of 453.55 g/mol. Its IUPAC name is 2H-indazol-3-ylmethanimine;4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-2-amine.
| Compound Name | 2H-indazol-3-ylmethanimine;4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 143049410 |
| Molecular Formula | C23H31N7O3 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | 2H-indazol-3-ylmethanimine;4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-2-amine |
| SMILES | Nc1cc(N2CCOCC2)cc(OCCN2CCOCC2)n1.[H]/N=C/c1[nH]nc2ccccc12 |
| InChI | InChI=1S/C15H24N4O3.C8H7N3/c16-14-11-13(19-4-8-21-9-5-19)12-15(17-14)22-10-3-18-1-6-20-7-2-18;9-5-8-6-3-1-2-4-7(6)10-11-8/h11-12H,1-10H2,(H2,16,17);1-5,9H,(H,10,11)/b;9-5+ |
| InChIKey | DXXNLLSXVPFWPS-DTDKZNDQSA-N |
| XLogP | 1.77 |
| TPSA | 125.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|