C20H22N5O4+ — CID 14304929
(2S)-2-amino-5-[4-[(1,4-dimethyl-2-oxopyrrolo[3,2-b]pyridin-4-ium-3-ylidene)amino]anilino]-5-oxopentanoic acid (PubChem CID 14304929) has the molecular formula C20H22N5O4+ and a molecular weight of 396.43 g/mol. Its IUPAC name is (2S)-2-amino-5-[4-[(1,4-dimethyl-2-oxopyrrolo[3,2-b]pyridin-4-ium-3-ylidene)amino]anilino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[4-[(1,4-dimethyl-2-oxopyrrolo[3,2-b]pyridin-4-ium-3-ylidene)amino]anilino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 14304929 |
| Molecular Formula | C20H22N5O4+ |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | (2S)-2-amino-5-[4-[(1,4-dimethyl-2-oxopyrrolo[3,2-b]pyridin-4-ium-3-ylidene)amino]anilino]-5-oxopentanoic acid |
| SMILES | CN1C(=O)/C(=N\c2ccc(NC(=O)CC[C@H](N)C(=O)O)cc2)c2c1ccc[n+]2C |
| InChI | InChI=1S/C20H21N5O4/c1-24-11-3-4-15-18(24)17(19(27)25(15)2)23-13-7-5-12(6-8-13)22-16(26)10-9-14(21)20(28)29/h3-8,11,14H,9-10,21H2,1-2H3,(H,28,29)/p+1/t14-/m0/s1 |
| InChIKey | JNINDPMWGOXTHV-AWEZNQCLSA-O |
| XLogP | 0.74 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|