C16H22BN3O4 — CID 143049705
[(2R)-1-[(4S)-4-benzamidopyrrolidine-2-carbonyl]pyrrolidin-2-yl]boronic acid (PubChem CID 143049705) has the molecular formula C16H22BN3O4 and a molecular weight of 331.18 g/mol. Its IUPAC name is [(2R)-1-[(4S)-4-benzamidopyrrolidine-2-carbonyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | [(2R)-1-[(4S)-4-benzamidopyrrolidine-2-carbonyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 143049705 |
| Molecular Formula | C16H22BN3O4 |
| Molecular Weight | 331.18 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | [(2R)-1-[(4S)-4-benzamidopyrrolidine-2-carbonyl]pyrrolidin-2-yl]boronic acid |
| SMILES | O=C(N[C@@H]1CNC(C(=O)N2CCC[C@H]2B(O)O)C1)c1ccccc1 |
| InChI | InChI=1S/C16H22BN3O4/c21-15(11-5-2-1-3-6-11)19-12-9-13(18-10-12)16(22)20-8-4-7-14(20)17(23)24/h1-3,5-6,12-14,18,23-24H,4,7-10H2,(H,19,21)/t12-,13?,14-/m0/s1 |
| InChIKey | ODVAICXIULRAFI-HPNRGHHYSA-N |
| XLogP | -0.85 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.18 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|