C21H27N5S — CID 143054066
4-(2-methyl-1-prop-1-en-2-ylsulfanylprop-1-enyl)-N-(4-piperazin-1-ylphenyl)pyrimidin-2-amine (PubChem CID 143054066) has the molecular formula C21H27N5S and a molecular weight of 381.55 g/mol. Its IUPAC name is 4-(2-methyl-1-prop-1-en-2-ylsulfanylprop-1-enyl)-N-(4-piperazin-1-ylphenyl)pyrimidin-2-amine.
| Compound Name | 4-(2-methyl-1-prop-1-en-2-ylsulfanylprop-1-enyl)-N-(4-piperazin-1-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 143054066 |
| Molecular Formula | C21H27N5S |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 4-(2-methyl-1-prop-1-en-2-ylsulfanylprop-1-enyl)-N-(4-piperazin-1-ylphenyl)pyrimidin-2-amine |
| SMILES | C=C(C)SC(=C(C)C)c1ccnc(Nc2ccc(N3CCNCC3)cc2)n1 |
| InChI | InChI=1S/C21H27N5S/c1-15(2)20(27-16(3)4)19-9-10-23-21(25-19)24-17-5-7-18(8-6-17)26-13-11-22-12-14-26/h5-10,22H,3,11-14H2,1-2,4H3,(H,23,24,25) |
| InChIKey | PTIIGHPLRMGHCV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|