About 6-bromo-1H-imidazo[4,5-b]pyridine-5-carbaldehyde
6-bromo-1H-imidazo[4,5-b]pyridine-5-carbaldehyde (PubChem CID 143055815) has the molecular formula C7H4BrN3O
and a molecular weight of 226.03 g/mol. Its IUPAC name is 6-bromo-1H-imidazo[4,5-b]pyridine-5-carbaldehyde.
Molecular Properties
| Compound Name | 6-bromo-1H-imidazo[4,5-b]pyridine-5-carbaldehyde |
| PubChem CID | 143055815 |
| Molecular Formula | C7H4BrN3O |
| Molecular Weight | 226.03 g/mol |
| Exact Mass | 224.95 |
| IUPAC Name | 6-bromo-1H-imidazo[4,5-b]pyridine-5-carbaldehyde |
| SMILES | O=Cc1nc2nc[nH]c2cc1Br |
| InChI | InChI=1S/C7H4BrN3O/c8-4-1-5-7(10-3-9-5)11-6(4)2-12/h1-3H,(H,9,10,11) |
| InChIKey | GHNNQVJCBIYVIC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.03 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1H-imidazo[4,5-b]pyridine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1H-imidazo[4,5-b]pyridine-5-carbaldehyde?
The IUPAC name of 6-bromo-1H-imidazo[4,5-b]pyridine-5-carbaldehyde (CID 143055815) is 6-bromo-1H-imidazo[4,5-b]pyridine-5-carbaldehyde.
What is the SMILES notation for 6-bromo-1H-imidazo[4,5-b]pyridine-5-carbaldehyde?
The canonical SMILES for 6-bromo-1H-imidazo[4,5-b]pyridine-5-carbaldehyde is O=Cc1nc2nc[nH]c2cc1Br.
What is the InChIKey of 6-bromo-1H-imidazo[4,5-b]pyridine-5-carbaldehyde?
The InChIKey is GHNNQVJCBIYVIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrN3O/c8-4-1-5-7(10-3-9-5)11-6(4)2-12/h1-3H,(H,9,10,11).
What are the key properties of 6-bromo-1H-imidazo[4,5-b]pyridine-5-carbaldehyde?
6-bromo-1H-imidazo[4,5-b]pyridine-5-carbaldehyde has a molecular weight of 226.03 g/mol, XLogP of 1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1H-imidazo[4,5-b]pyridine-5-carbaldehyde is sourced from PubChem (CID 143055815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).