C23H44O2 — CID 143056338
(7aR)-3a,7a-dimethyl-1-propan-2-yl-1,2,3,5,6,7-hexahydroinden-4-one;(3S)-2,3-dimethylpent-4-en-2-ol;ethane (PubChem CID 143056338) has the molecular formula C23H44O2 and a molecular weight of 352.60 g/mol. Its IUPAC name is (7aR)-3a,7a-dimethyl-1-propan-2-yl-1,2,3,5,6,7-hexahydroinden-4-one;(3S)-2,3-dimethylpent-4-en-2-ol;ethane.
| Compound Name | (7aR)-3a,7a-dimethyl-1-propan-2-yl-1,2,3,5,6,7-hexahydroinden-4-one;(3S)-2,3-dimethylpent-4-en-2-ol;ethane |
|---|---|
| PubChem CID | 143056338 |
| Molecular Formula | C23H44O2 |
| Molecular Weight | 352.60 g/mol |
| Exact Mass | 352.33 |
| IUPAC Name | (7aR)-3a,7a-dimethyl-1-propan-2-yl-1,2,3,5,6,7-hexahydroinden-4-one;(3S)-2,3-dimethylpent-4-en-2-ol;ethane |
| SMILES | C=C[C@H](C)C(C)(C)O.CC.CC(C)C1CCC2(C)C(=O)CCC[C@]12C |
| InChI | InChI=1S/C14H24O.C7H14O.C2H6/c1-10(2)11-7-9-14(4)12(15)6-5-8-13(11,14)3;1-5-6(2)7(3,4)8;1-2/h10-11H,5-9H2,1-4H3;5-6,8H,1H2,2-4H3;1-2H3/t11?,13-,14?;6-;/m10./s1 |
| InChIKey | GAGFYKHWJLXTPY-IRXXQGJLSA-N |
| XLogP | 6.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.60 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|