About N-tert-butyl-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butan-1-amine;2-methylpentan-3-one
N-tert-butyl-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butan-1-amine;2-methylpentan-3-one (PubChem CID 143058117) has the molecular formula C20H43NO2
and a molecular weight of 329.57 g/mol. Its IUPAC name is N-tert-butyl-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butan-1-amine;2-methylpentan-3-one.
Molecular Properties
| Compound Name | N-tert-butyl-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butan-1-amine;2-methylpentan-3-one |
| PubChem CID | 143058117 |
| Molecular Formula | C20H43NO2 |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 329.33 |
| IUPAC Name | N-tert-butyl-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butan-1-amine;2-methylpentan-3-one |
| SMILES | CC(C)(CCOC(C)(C)C)CNC(C)(C)C.CCC(=O)C(C)C |
| InChI | InChI=1S/C14H31NO.C6H12O/c1-12(2,3)15-11-14(7,8)9-10-16-13(4,5)6;1-4-6(7)5(2)3/h15H,9-11H2,1-8H3;5H,4H2,1-3H3 |
| InChIKey | NYSNDNKJSJEZHD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butan-1-amine;2-methylpentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butan-1-amine;2-methylpentan-3-one?
The IUPAC name of N-tert-butyl-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butan-1-amine;2-methylpentan-3-one (CID 143058117) is N-tert-butyl-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butan-1-amine;2-methylpentan-3-one.
What is the SMILES notation for N-tert-butyl-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butan-1-amine;2-methylpentan-3-one?
The canonical SMILES for N-tert-butyl-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butan-1-amine;2-methylpentan-3-one is CC(C)(CCOC(C)(C)C)CNC(C)(C)C.CCC(=O)C(C)C.
What is the InChIKey of N-tert-butyl-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butan-1-amine;2-methylpentan-3-one?
The InChIKey is NYSNDNKJSJEZHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31NO.C6H12O/c1-12(2,3)15-11-14(7,8)9-10-16-13(4,5)6;1-4-6(7)5(2)3/h15H,9-11H2,1-8H3;5H,4H2,1-3H3.
What are the key properties of N-tert-butyl-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butan-1-amine;2-methylpentan-3-one?
N-tert-butyl-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butan-1-amine;2-methylpentan-3-one has a molecular weight of 329.57 g/mol, XLogP of 5.23, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butan-1-amine;2-methylpentan-3-one is sourced from PubChem (CID 143058117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).