C11H18O2 — CID 143068364
2-[(2Z,4Z,6Z)-octa-2,4,6-trien-3-yl]oxypropan-1-ol (PubChem CID 143068364) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 2-[(2Z,4Z,6Z)-octa-2,4,6-trien-3-yl]oxypropan-1-ol.
| Compound Name | 2-[(2Z,4Z,6Z)-octa-2,4,6-trien-3-yl]oxypropan-1-ol |
|---|---|
| PubChem CID | 143068364 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 2-[(2Z,4Z,6Z)-octa-2,4,6-trien-3-yl]oxypropan-1-ol |
| SMILES | C/C=C\C=C/C(=C/C)OC(C)CO |
| InChI | InChI=1S/C11H18O2/c1-4-6-7-8-11(5-2)13-10(3)9-12/h4-8,10,12H,9H2,1-3H3/b6-4-,8-7-,11-5- |
| InChIKey | ZNTZYAUEBWRYKI-UMWQDMCKSA-N |
| XLogP | 2.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|