C11H19N3 — CID 143068959
N-(4-aminophenyl)-N,N'-dimethylmethanimidamide;ethane (PubChem CID 143068959) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N-(4-aminophenyl)-N,N'-dimethylmethanimidamide;ethane.
| Compound Name | N-(4-aminophenyl)-N,N'-dimethylmethanimidamide;ethane |
|---|---|
| PubChem CID | 143068959 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N-(4-aminophenyl)-N,N'-dimethylmethanimidamide;ethane |
| SMILES | C/N=C/N(C)c1ccc(N)cc1.CC |
| InChI | InChI=1S/C9H13N3.C2H6/c1-11-7-12(2)9-5-3-8(10)4-6-9;1-2/h3-7H,10H2,1-2H3;1-2H3/b11-7+; |
| InChIKey | XDTIUEIRGDAATM-RVDQCCQOSA-N |
| XLogP | 2.39 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|