C17H16F3NO2 — CID 143071183
(2E,4E)-5-methoxy-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]hepta-2,4,6-trienamide (PubChem CID 143071183) has the molecular formula C17H16F3NO2 and a molecular weight of 323.31 g/mol. Its IUPAC name is (2E,4E)-5-methoxy-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]hepta-2,4,6-trienamide.
| Compound Name | (2E,4E)-5-methoxy-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]hepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 143071183 |
| Molecular Formula | C17H16F3NO2 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (2E,4E)-5-methoxy-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]hepta-2,4,6-trienamide |
| SMILES | C=C/C(OC)=C(\C=C\C(N)=O)/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F3NO2/c1-3-15(23-2)13(8-11-16(21)22)7-4-12-5-9-14(10-6-12)17(18,19)20/h3-11H,1H2,2H3,(H2,21,22)/b7-4+,11-8+,15-13+ |
| InChIKey | HMDSSPBQMHFCJX-LJRGHFSVSA-N |
| XLogP | 3.85 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|