C24H37N2OP — CID 143073927
1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3-[(1-cyclopropylidene-2-phosphanylethyl)amino]-4-phenylbutan-2-ol (PubChem CID 143073927) has the molecular formula C24H37N2OP and a molecular weight of 400.55 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3-[(1-cyclopropylidene-2-phosphanylethyl)amino]-4-phenylbutan-2-ol.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3-[(1-cyclopropylidene-2-phosphanylethyl)amino]-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 143073927 |
| Molecular Formula | C24H37N2OP |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3-[(1-cyclopropylidene-2-phosphanylethyl)amino]-4-phenylbutan-2-ol |
| SMILES | OC(CN1CCC2CCCCC2C1)C(Cc1ccccc1)NC(CP)=C1CC1 |
| InChI | InChI=1S/C24H37N2OP/c27-24(16-26-13-12-19-8-4-5-9-21(19)15-26)22(14-18-6-2-1-3-7-18)25-23(17-28)20-10-11-20/h1-3,6-7,19,21-22,24-25,27H,4-5,8-17,28H2 |
| InChIKey | MRYSBTHTCSLVLL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|