C22H34N2O2 — CID 163483331
1-[[(3R)-4-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylbutan-2-yl]amino]propan-2-one (PubChem CID 163483331) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 1-[[(3R)-4-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylbutan-2-yl]amino]propan-2-one.
| Compound Name | 1-[[(3R)-4-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylbutan-2-yl]amino]propan-2-one |
|---|---|
| PubChem CID | 163483331 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | 1-[[(3R)-4-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylbutan-2-yl]amino]propan-2-one |
| SMILES | CC(=O)CNC(Cc1ccccc1)[C@H](O)CN1CC[C@@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C22H34N2O2/c1-17(25)14-23-21(13-18-7-3-2-4-8-18)22(26)16-24-12-11-19-9-5-6-10-20(19)15-24/h2-4,7-8,19-23,26H,5-6,9-16H2,1H3/t19-,20+,21?,22+/m0/s1 |
| InChIKey | CGLGRSJUKVGSJK-ICOBXAEASA-N |
| XLogP | 2.65 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |