C11H17NO2 — CID 143073997
3-[(3E)-6-methylhepta-1,3,5-trien-3-yl]oxypropanamide (PubChem CID 143073997) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 3-[(3E)-6-methylhepta-1,3,5-trien-3-yl]oxypropanamide.
| Compound Name | 3-[(3E)-6-methylhepta-1,3,5-trien-3-yl]oxypropanamide |
|---|---|
| PubChem CID | 143073997 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 3-[(3E)-6-methylhepta-1,3,5-trien-3-yl]oxypropanamide |
| SMILES | C=C/C(=C\C=C(C)C)OCCC(N)=O |
| InChI | InChI=1S/C11H17NO2/c1-4-10(6-5-9(2)3)14-8-7-11(12)13/h4-6H,1,7-8H2,2-3H3,(H2,12,13)/b10-6+ |
| InChIKey | JERRKVZHZYSGTA-UXBLZVDNSA-N |
| XLogP | 1.91 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|