C30H40N4O6 — CID 143074271
ethane;N-[2-[3-ethyl-1-(3-nitrobenzoyl)-2H-indol-3-yl]ethyl]-2-methylprop-2-enamide;(E)-2-nitropent-2-ene (PubChem CID 143074271) has the molecular formula C30H40N4O6 and a molecular weight of 552.67 g/mol. Its IUPAC name is ethane;N-[2-[3-ethyl-1-(3-nitrobenzoyl)-2H-indol-3-yl]ethyl]-2-methylprop-2-enamide;(E)-2-nitropent-2-ene.
| Compound Name | ethane;N-[2-[3-ethyl-1-(3-nitrobenzoyl)-2H-indol-3-yl]ethyl]-2-methylprop-2-enamide;(E)-2-nitropent-2-ene |
|---|---|
| PubChem CID | 143074271 |
| Molecular Formula | C30H40N4O6 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | ethane;N-[2-[3-ethyl-1-(3-nitrobenzoyl)-2H-indol-3-yl]ethyl]-2-methylprop-2-enamide;(E)-2-nitropent-2-ene |
| SMILES | C=C(C)C(=O)NCCC1(CC)CN(C(=O)c2cccc([N+](=O)[O-])c2)c2ccccc21.CC.CC/C=C(\C)[N+](=O)[O-] |
| InChI | InChI=1S/C23H25N3O4.C5H9NO2.C2H6/c1-4-23(12-13-24-21(27)16(2)3)15-25(20-11-6-5-10-19(20)23)22(28)17-8-7-9-18(14-17)26(29)30;1-3-4-5(2)6(7)8;1-2/h5-11,14H,2,4,12-13,15H2,1,3H3,(H,24,27);4H,3H2,1-2H3;1-2H3/b;5-4+; |
| InChIKey | BBRFWFMEALZVTL-YHVJRZKVSA-N |
| XLogP | 6.59 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|