C26H34FN3O3 — CID 143074143
cyclopropane;[3-ethyl-5-fluoro-3-[2-[methyl(propyl)amino]ethyl]-2H-indol-1-yl]-(3-nitrophenyl)methanone (PubChem CID 143074143) has the molecular formula C26H34FN3O3 and a molecular weight of 455.57 g/mol. Its IUPAC name is cyclopropane;[3-ethyl-5-fluoro-3-[2-[methyl(propyl)amino]ethyl]-2H-indol-1-yl]-(3-nitrophenyl)methanone.
| Compound Name | cyclopropane;[3-ethyl-5-fluoro-3-[2-[methyl(propyl)amino]ethyl]-2H-indol-1-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 143074143 |
| Molecular Formula | C26H34FN3O3 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | cyclopropane;[3-ethyl-5-fluoro-3-[2-[methyl(propyl)amino]ethyl]-2H-indol-1-yl]-(3-nitrophenyl)methanone |
| SMILES | C1CC1.CCCN(C)CCC1(CC)CN(C(=O)c2cccc([N+](=O)[O-])c2)c2ccc(F)cc21 |
| InChI | InChI=1S/C23H28FN3O3.C3H6/c1-4-12-25(3)13-11-23(5-2)16-26(21-10-9-18(24)15-20(21)23)22(28)17-7-6-8-19(14-17)27(29)30;1-2-3-1/h6-10,14-15H,4-5,11-13,16H2,1-3H3;1-3H2 |
| InChIKey | MJWKPTURRYTMAB-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|