C16H20N4O3S2 — CID 143077331
3-[[4-[[(Z)-2-ethylsulfanylpent-2-enyl]amino]-1-oxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxybenzaldehyde (PubChem CID 143077331) has the molecular formula C16H20N4O3S2 and a molecular weight of 380.50 g/mol. Its IUPAC name is 3-[[4-[[(Z)-2-ethylsulfanylpent-2-enyl]amino]-1-oxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxybenzaldehyde.
| Compound Name | 3-[[4-[[(Z)-2-ethylsulfanylpent-2-enyl]amino]-1-oxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 143077331 |
| Molecular Formula | C16H20N4O3S2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 3-[[4-[[(Z)-2-ethylsulfanylpent-2-enyl]amino]-1-oxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxybenzaldehyde |
| SMILES | CC/C=C(/CNC1=NS(=O)N=C1Nc1cccc(C=O)c1O)SCC |
| InChI | InChI=1S/C16H20N4O3S2/c1-3-6-12(24-4-2)9-17-15-16(20-25(23)19-15)18-13-8-5-7-11(10-21)14(13)22/h5-8,10,22H,3-4,9H2,1-2H3,(H,17,19)(H,18,20)/b12-6- |
| InChIKey | BRAOZSYLIOHIGP-SDQBBNPISA-N |
| XLogP | 2.64 |
| TPSA | 103.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|