C12H13F14N — CID 143087546
6,7,7,7-tetrafluoro-2-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptan-1-amine (PubChem CID 143087546) has the molecular formula C12H13F14N and a molecular weight of 437.22 g/mol. Its IUPAC name is 6,7,7,7-tetrafluoro-2-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptan-1-amine.
| Compound Name | 6,7,7,7-tetrafluoro-2-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptan-1-amine |
|---|---|
| PubChem CID | 143087546 |
| Molecular Formula | C12H13F14N |
| Molecular Weight | 437.22 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 6,7,7,7-tetrafluoro-2-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptan-1-amine |
| SMILES | NCC(CCCC(F)(C(F)(F)F)C(F)(F)F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H13F14N/c13-7(9(15,16)17,10(18,19)20)3-1-2-6(5-27)4-8(14,11(21,22)23)12(24,25)26/h6H,1-5,27H2 |
| InChIKey | LKWRUNPOQDNYBZ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.22 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |