C22H22ClNO7S — CID 143088591
2-chloro-5-[5-[(Z)-[3-(2-ethoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-3-methylfuran-2-yl]benzoic acid;ethane (PubChem CID 143088591) has the molecular formula C22H22ClNO7S and a molecular weight of 479.94 g/mol. Its IUPAC name is 2-chloro-5-[5-[(Z)-[3-(2-ethoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-3-methylfuran-2-yl]benzoic acid;ethane.
| Compound Name | 2-chloro-5-[5-[(Z)-[3-(2-ethoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-3-methylfuran-2-yl]benzoic acid;ethane |
|---|---|
| PubChem CID | 143088591 |
| Molecular Formula | C22H22ClNO7S |
| Molecular Weight | 479.94 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 2-chloro-5-[5-[(Z)-[3-(2-ethoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-3-methylfuran-2-yl]benzoic acid;ethane |
| SMILES | CC.CCOC(=O)CN1C(=O)S/C(=C\c2cc(C)c(-c3ccc(Cl)c(C(=O)O)c3)o2)C1=O |
| InChI | InChI=1S/C20H16ClNO7S.C2H6/c1-3-28-16(23)9-22-18(24)15(30-20(22)27)8-12-6-10(2)17(29-12)11-4-5-14(21)13(7-11)19(25)26;1-2/h4-8H,3,9H2,1-2H3,(H,25,26);1-2H3/b15-8-; |
| InChIKey | SUIFQZOFJWVDSM-ZTXYIFKNSA-N |
| XLogP | 5.23 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.94 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|