C22H33FO2S — CID 143096673
ethyl 2-[2-fluoro-4-(3-methylbutan-2-yl)-5-(5-methylhex-4-en-2-yl)phenyl]sulfanylacetate (PubChem CID 143096673) has the molecular formula C22H33FO2S and a molecular weight of 380.57 g/mol. Its IUPAC name is ethyl 2-[2-fluoro-4-(3-methylbutan-2-yl)-5-(5-methylhex-4-en-2-yl)phenyl]sulfanylacetate.
| Compound Name | ethyl 2-[2-fluoro-4-(3-methylbutan-2-yl)-5-(5-methylhex-4-en-2-yl)phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 143096673 |
| Molecular Formula | C22H33FO2S |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | ethyl 2-[2-fluoro-4-(3-methylbutan-2-yl)-5-(5-methylhex-4-en-2-yl)phenyl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1cc(C(C)CC=C(C)C)c(C(C)C(C)C)cc1F |
| InChI | InChI=1S/C22H33FO2S/c1-8-25-22(24)13-26-21-12-18(16(6)10-9-14(2)3)19(11-20(21)23)17(7)15(4)5/h9,11-12,15-17H,8,10,13H2,1-7H3 |
| InChIKey | LKWFIIQRWSZSDC-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|