C9H13NS — CID 143096915
(5Z,7Z)-2,4-dimethyl-4,9-dihydro-1,3-thiazonine (PubChem CID 143096915) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is (5Z,7Z)-2,4-dimethyl-4,9-dihydro-1,3-thiazonine.
| Compound Name | (5Z,7Z)-2,4-dimethyl-4,9-dihydro-1,3-thiazonine |
|---|---|
| PubChem CID | 143096915 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | (5Z,7Z)-2,4-dimethyl-4,9-dihydro-1,3-thiazonine |
| SMILES | C/C1=N/C(C)/C=C\C=C/CS1 |
| InChI | InChI=1S/C9H13NS/c1-8-6-4-3-5-7-11-9(2)10-8/h3-6,8H,7H2,1-2H3/b5-3-,6-4-,10-9- |
| InChIKey | YALGQFGJXINCFE-WQOYSYRISA-N |
| XLogP | 2.65 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |