C16H21NO — CID 143098941
(3Z,6E)-5-methylimino-6-[(Z)-prop-1-enyl]-3-prop-1-en-2-ylnona-3,6,8-trien-2-one (PubChem CID 143098941) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is (3Z,6E)-5-methylimino-6-[(Z)-prop-1-enyl]-3-prop-1-en-2-ylnona-3,6,8-trien-2-one.
| Compound Name | (3Z,6E)-5-methylimino-6-[(Z)-prop-1-enyl]-3-prop-1-en-2-ylnona-3,6,8-trien-2-one |
|---|---|
| PubChem CID | 143098941 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (3Z,6E)-5-methylimino-6-[(Z)-prop-1-enyl]-3-prop-1-en-2-ylnona-3,6,8-trien-2-one |
| SMILES | C=C/C=C(\C=C/C)C(/C=C(\C(=C)C)C(C)=O)=N\C |
| InChI | InChI=1S/C16H21NO/c1-7-9-14(10-8-2)16(17-6)11-15(12(3)4)13(5)18/h7-11H,1,3H2,2,4-6H3/b10-8-,14-9+,15-11-,17-16- |
| InChIKey | ZFNUPPCAZBXHDA-HPZNDMTFSA-N |
| XLogP | 3.84 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|