C29H42F3NO5S — CID 143101034
(7R,8S,9S,10S,13E,16S)-8-hydroxy-16-[(E)-1-[2-(hydroxymethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-5,5,7,9,10,11-hexamethyl-13-(trifluoromethyl)-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 143101034) has the molecular formula C29H42F3NO5S and a molecular weight of 573.72 g/mol. Its IUPAC name is (7R,8S,9S,10S,13E,16S)-8-hydroxy-16-[(E)-1-[2-(hydroxymethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-5,5,7,9,10,11-hexamethyl-13-(trifluoromethyl)-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (7R,8S,9S,10S,13E,16S)-8-hydroxy-16-[(E)-1-[2-(hydroxymethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-5,5,7,9,10,11-hexamethyl-13-(trifluoromethyl)-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 143101034 |
| Molecular Formula | C29H42F3NO5S |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | (7R,8S,9S,10S,13E,16S)-8-hydroxy-16-[(E)-1-[2-(hydroxymethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-5,5,7,9,10,11-hexamethyl-13-(trifluoromethyl)-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C(=C\c1csc(CO)n1)[C@@H]1C/C=C(/C(F)(F)F)CC(C)[C@H](C)[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)CCC(=O)O1 |
| InChI | InChI=1S/C29H42F3NO5S/c1-16-12-21(29(30,31)32)8-9-23(17(2)13-22-15-39-24(14-34)33-22)38-25(35)10-11-28(6,7)27(37)20(5)26(36)19(4)18(16)3/h8,13,15-16,18-20,23,26,34,36H,9-12,14H2,1-7H3/b17-13+,21-8+/t16?,18-,19-,20+,23-,26-/m0/s1 |
| InChIKey | HDSNDLDFSXLOEX-XDICCBHASA-N |
| XLogP | 6.51 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|