C29H42FNO4S — CID 142880374
(11Z,15Z)-18-[(E)-1-[2-(fluoromethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-8-hydroxy-5,5,7,9,15-pentamethyl-1-oxacyclooctadeca-11,15-diene-2,6-dione (PubChem CID 142880374) has the molecular formula C29H42FNO4S and a molecular weight of 519.72 g/mol. Its IUPAC name is (11Z,15Z)-18-[(E)-1-[2-(fluoromethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-8-hydroxy-5,5,7,9,15-pentamethyl-1-oxacyclooctadeca-11,15-diene-2,6-dione.
| Compound Name | (11Z,15Z)-18-[(E)-1-[2-(fluoromethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-8-hydroxy-5,5,7,9,15-pentamethyl-1-oxacyclooctadeca-11,15-diene-2,6-dione |
|---|---|
| PubChem CID | 142880374 |
| Molecular Formula | C29H42FNO4S |
| Molecular Weight | 519.72 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | (11Z,15Z)-18-[(E)-1-[2-(fluoromethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-8-hydroxy-5,5,7,9,15-pentamethyl-1-oxacyclooctadeca-11,15-diene-2,6-dione |
| SMILES | C/C1=C/CC(/C(C)=C/c2csc(CF)n2)OC(=O)CCC(C)(C)C(=O)C(C)C(O)C(C)C/C=C\CC1 |
| InChI | InChI=1S/C29H42FNO4S/c1-19-10-8-7-9-11-20(2)27(33)22(4)28(34)29(5,6)15-14-26(32)35-24(13-12-19)21(3)16-23-18-36-25(17-30)31-23/h7,9,12,16,18,20,22,24,27,33H,8,10-11,13-15,17H2,1-6H3/b9-7-,19-12-,21-16+ |
| InChIKey | WRRHHUBSSFJHJO-ICBCYUJASA-N |
| XLogP | 7.01 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.72 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|