C11H25NO2 — CID 143101250
(2R,4S,6R)-2,4-dimethyl-6-nitrosooxane;ethane (PubChem CID 143101250) has the molecular formula C11H25NO2 and a molecular weight of 203.33 g/mol. Its IUPAC name is (2R,4S,6R)-2,4-dimethyl-6-nitrosooxane;ethane.
| Compound Name | (2R,4S,6R)-2,4-dimethyl-6-nitrosooxane;ethane |
|---|---|
| PubChem CID | 143101250 |
| Molecular Formula | C11H25NO2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.19 |
| IUPAC Name | (2R,4S,6R)-2,4-dimethyl-6-nitrosooxane;ethane |
| SMILES | CC.CC.C[C@H]1C[C@@H](C)O[C@@H](N=O)C1 |
| InChI | InChI=1S/C7H13NO2.2C2H6/c1-5-3-6(2)10-7(4-5)8-9;2*1-2/h5-7H,3-4H2,1-2H3;2*1-2H3/t5-,6+,7+;;/m0../s1 |
| InChIKey | GFXRWDDIKJHYHS-OJSHLMAWSA-N |
| XLogP | 3.97 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |