C12H27N — CID 143101554
ethane;N,3,4-trimethylpent-3-en-2-imine (PubChem CID 143101554) has the molecular formula C12H27N and a molecular weight of 185.35 g/mol. Its IUPAC name is ethane;N,3,4-trimethylpent-3-en-2-imine.
| Compound Name | ethane;N,3,4-trimethylpent-3-en-2-imine |
|---|---|
| PubChem CID | 143101554 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | ethane;N,3,4-trimethylpent-3-en-2-imine |
| SMILES | C/N=C(\C)C(C)=C(C)C.CC.CC |
| InChI | InChI=1S/C8H15N.2C2H6/c1-6(2)7(3)8(4)9-5;2*1-2/h1-5H3;2*1-2H3/b9-8+;; |
| InChIKey | YNGQZYIRMFDUFN-YEUQMBKVSA-N |
| XLogP | 4.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|