C18H30NO2+ — CID 143106574
(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylidene-hydroxy-propan-2-ylazanium (PubChem CID 143106574) has the molecular formula C18H30NO2+ and a molecular weight of 292.44 g/mol. Its IUPAC name is (Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylidene-hydroxy-propan-2-ylazanium.
| Compound Name | (Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylidene-hydroxy-propan-2-ylazanium |
|---|---|
| PubChem CID | 143106574 |
| Molecular Formula | C18H30NO2+ |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | (Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylidene-hydroxy-propan-2-ylazanium |
| SMILES | CC(C)/[N+](O)=C/c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H29NO2/c1-12(2)19(21)11-13-9-14(17(3,4)5)16(20)15(10-13)18(6,7)8/h9-12,21H,1-8H3/p+1 |
| InChIKey | WPRQRUJLOSWNLR-UHFFFAOYSA-O |
| XLogP | 4.22 |
| TPSA | 43.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|