C9H12FN — CID 143106717
N-ethyl-4-fluorocyclohepta-1,3,5-trien-1-amine (PubChem CID 143106717) has the molecular formula C9H12FN and a molecular weight of 153.20 g/mol. Its IUPAC name is N-ethyl-4-fluorocyclohepta-1,3,5-trien-1-amine.
| Compound Name | N-ethyl-4-fluorocyclohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 143106717 |
| Molecular Formula | C9H12FN |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | N-ethyl-4-fluorocyclohepta-1,3,5-trien-1-amine |
| SMILES | CCNC1=CC=C(F)C=CC1 |
| InChI | InChI=1S/C9H12FN/c1-2-11-9-5-3-4-8(10)6-7-9/h3-4,6-7,11H,2,5H2,1H3 |
| InChIKey | OQBZPEADZOASJR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |