C8H10FN3O2S — CID 143108154
fluoro 2-piperazin-1-yl-1,3-thiazole-5-carboxylate (PubChem CID 143108154) has the molecular formula C8H10FN3O2S and a molecular weight of 231.25 g/mol. Its IUPAC name is fluoro 2-piperazin-1-yl-1,3-thiazole-5-carboxylate.
| Compound Name | fluoro 2-piperazin-1-yl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 143108154 |
| Molecular Formula | C8H10FN3O2S |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | fluoro 2-piperazin-1-yl-1,3-thiazole-5-carboxylate |
| SMILES | O=C(OF)c1cnc(N2CCNCC2)s1 |
| InChI | InChI=1S/C8H10FN3O2S/c9-14-7(13)6-5-11-8(15-6)12-3-1-10-2-4-12/h5,10H,1-4H2 |
| InChIKey | RTKQUWHYWACGQJ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |