C21H24N2OS — CID 143113464
2-hexan-3-ylsulfanyl-7-methyl-1-phenyl-1,6-naphthyridin-4-one (PubChem CID 143113464) has the molecular formula C21H24N2OS and a molecular weight of 352.50 g/mol. Its IUPAC name is 2-hexan-3-ylsulfanyl-7-methyl-1-phenyl-1,6-naphthyridin-4-one.
| Compound Name | 2-hexan-3-ylsulfanyl-7-methyl-1-phenyl-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 143113464 |
| Molecular Formula | C21H24N2OS |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-hexan-3-ylsulfanyl-7-methyl-1-phenyl-1,6-naphthyridin-4-one |
| SMILES | CCCC(CC)Sc1cc(=O)c2cnc(C)cc2n1-c1ccccc1 |
| InChI | InChI=1S/C21H24N2OS/c1-4-9-17(5-2)25-21-13-20(24)18-14-22-15(3)12-19(18)23(21)16-10-7-6-8-11-16/h6-8,10-14,17H,4-5,9H2,1-3H3 |
| InChIKey | BNPOYQYRCSHWNX-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |