C23H20N2OS — CID 58694544
2-benzyl-7-ethylsulfanyl-1-phenyl-1,6-naphthyridin-4-one (PubChem CID 58694544) has the molecular formula C23H20N2OS and a molecular weight of 372.49 g/mol. Its IUPAC name is 2-benzyl-7-ethylsulfanyl-1-phenyl-1,6-naphthyridin-4-one.
| Compound Name | 2-benzyl-7-ethylsulfanyl-1-phenyl-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 58694544 |
| Molecular Formula | C23H20N2OS |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 2-benzyl-7-ethylsulfanyl-1-phenyl-1,6-naphthyridin-4-one |
| SMILES | CCSc1cc2c(cn1)c(=O)cc(Cc1ccccc1)n2-c1ccccc1 |
| InChI | InChI=1S/C23H20N2OS/c1-2-27-23-15-21-20(16-24-23)22(26)14-19(13-17-9-5-3-6-10-17)25(21)18-11-7-4-8-12-18/h3-12,14-16H,2,13H2,1H3 |
| InChIKey | IAKKPIWBXDLEPC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |