C28H37N3O2S — CID 142224880
ethane;(3Z)-hexa-1,3,5-triene;N-(7-methyl-4-oxo-1-phenyl-1,6-naphthyridin-2-yl)pentane-3-sulfinamide (PubChem CID 142224880) has the molecular formula C28H37N3O2S and a molecular weight of 479.69 g/mol. Its IUPAC name is ethane;(3Z)-hexa-1,3,5-triene;N-(7-methyl-4-oxo-1-phenyl-1,6-naphthyridin-2-yl)pentane-3-sulfinamide.
| Compound Name | ethane;(3Z)-hexa-1,3,5-triene;N-(7-methyl-4-oxo-1-phenyl-1,6-naphthyridin-2-yl)pentane-3-sulfinamide |
|---|---|
| PubChem CID | 142224880 |
| Molecular Formula | C28H37N3O2S |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | ethane;(3Z)-hexa-1,3,5-triene;N-(7-methyl-4-oxo-1-phenyl-1,6-naphthyridin-2-yl)pentane-3-sulfinamide |
| SMILES | C=C/C=C\C=C.CC.CCC(CC)S(=O)Nc1cc(=O)c2cnc(C)cc2n1-c1ccccc1 |
| InChI | InChI=1S/C20H23N3O2S.C6H8.C2H6/c1-4-16(5-2)26(25)22-20-12-19(24)17-13-21-14(3)11-18(17)23(20)15-9-7-6-8-10-15;1-3-5-6-4-2;1-2/h6-13,16,22H,4-5H2,1-3H3;3-6H,1-2H2;1-2H3/b;6-5-; |
| InChIKey | SKJWLIZSNODPMR-XRPAZMCKSA-N |
| XLogP | 6.90 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|