C22H26Cl2FN3O3S — CID 143116395
2,4-dichloro-5-fluoro-N-[[4-(6-methoxy-2-pyridinyl)-1-propylsulfinylpiperidin-4-yl]methyl]benzamide (PubChem CID 143116395) has the molecular formula C22H26Cl2FN3O3S and a molecular weight of 502.44 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-[[4-(6-methoxy-2-pyridinyl)-1-propylsulfinylpiperidin-4-yl]methyl]benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-[[4-(6-methoxy-2-pyridinyl)-1-propylsulfinylpiperidin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 143116395 |
| Molecular Formula | C22H26Cl2FN3O3S |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-[[4-(6-methoxy-2-pyridinyl)-1-propylsulfinylpiperidin-4-yl]methyl]benzamide |
| SMILES | CCCS(=O)N1CCC(CNC(=O)c2cc(F)c(Cl)cc2Cl)(c2cccc(OC)n2)CC1 |
| InChI | InChI=1S/C22H26Cl2FN3O3S/c1-3-11-32(30)28-9-7-22(8-10-28,19-5-4-6-20(27-19)31-2)14-26-21(29)15-12-18(25)17(24)13-16(15)23/h4-6,12-13H,3,7-11,14H2,1-2H3,(H,26,29) |
| InChIKey | SFTLTUXKAGPYKE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|