C28H31ClO5 — CID 143117930
(2R,3S,4S,5S)-6-[(4-chlorophenyl)methoxymethyl]-5-ethenyl-2-(methoxymethyl)-4-(naphthalen-2-ylmethoxy)oxan-3-ol (PubChem CID 143117930) has the molecular formula C28H31ClO5 and a molecular weight of 483.00 g/mol. Its IUPAC name is (2R,3S,4S,5S)-6-[(4-chlorophenyl)methoxymethyl]-5-ethenyl-2-(methoxymethyl)-4-(naphthalen-2-ylmethoxy)oxan-3-ol.
| Compound Name | (2R,3S,4S,5S)-6-[(4-chlorophenyl)methoxymethyl]-5-ethenyl-2-(methoxymethyl)-4-(naphthalen-2-ylmethoxy)oxan-3-ol |
|---|---|
| PubChem CID | 143117930 |
| Molecular Formula | C28H31ClO5 |
| Molecular Weight | 483.00 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | (2R,3S,4S,5S)-6-[(4-chlorophenyl)methoxymethyl]-5-ethenyl-2-(methoxymethyl)-4-(naphthalen-2-ylmethoxy)oxan-3-ol |
| SMILES | C=C[C@H]1C(COCc2ccc(Cl)cc2)O[C@H](COC)[C@@H](O)[C@H]1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H31ClO5/c1-3-24-25(18-32-15-19-9-12-23(29)13-10-19)34-26(17-31-2)27(30)28(24)33-16-20-8-11-21-6-4-5-7-22(21)14-20/h3-14,24-28,30H,1,15-18H2,2H3/t24-,25?,26+,27+,28-/m0/s1 |
| InChIKey | NIYUVEOVICYHRH-XIMUGKOGSA-N |
| XLogP | 5.17 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.00 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|