C28H39N3O3 — CID 143127003
3-[6-[3-(dimethylamino)pyrrolidin-1-yl]-3-pyridinyl]-7-methoxychromen-4-one;ethane;2-methylbut-2-ene (PubChem CID 143127003) has the molecular formula C28H39N3O3 and a molecular weight of 465.64 g/mol. Its IUPAC name is 3-[6-[3-(dimethylamino)pyrrolidin-1-yl]-3-pyridinyl]-7-methoxychromen-4-one;ethane;2-methylbut-2-ene.
| Compound Name | 3-[6-[3-(dimethylamino)pyrrolidin-1-yl]-3-pyridinyl]-7-methoxychromen-4-one;ethane;2-methylbut-2-ene |
|---|---|
| PubChem CID | 143127003 |
| Molecular Formula | C28H39N3O3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | 3-[6-[3-(dimethylamino)pyrrolidin-1-yl]-3-pyridinyl]-7-methoxychromen-4-one;ethane;2-methylbut-2-ene |
| SMILES | CC.CC=C(C)C.COc1ccc2c(=O)c(-c3ccc(N4CCC(N(C)C)C4)nc3)coc2c1 |
| InChI | InChI=1S/C21H23N3O3.C5H10.C2H6/c1-23(2)15-8-9-24(12-15)20-7-4-14(11-22-20)18-13-27-19-10-16(26-3)5-6-17(19)21(18)25;1-4-5(2)3;1-2/h4-7,10-11,13,15H,8-9,12H2,1-3H3;4H,1-3H3;1-2H3 |
| InChIKey | LLZIZHBUSGLQNA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|