C25H32N4O3S2 — CID 143137273
S-[N'-[4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]ethyl]phenyl]carbamimidoyl] 4-hydroxypent-4-enethioate;propane (PubChem CID 143137273) has the molecular formula C25H32N4O3S2 and a molecular weight of 500.69 g/mol. Its IUPAC name is S-[N'-[4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]ethyl]phenyl]carbamimidoyl] 4-hydroxypent-4-enethioate;propane.
| Compound Name | S-[N'-[4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]ethyl]phenyl]carbamimidoyl] 4-hydroxypent-4-enethioate;propane |
|---|---|
| PubChem CID | 143137273 |
| Molecular Formula | C25H32N4O3S2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | S-[N'-[4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]ethyl]phenyl]carbamimidoyl] 4-hydroxypent-4-enethioate;propane |
| SMILES | C=C(O)CCC(=O)S/C(N)=N/c1ccc(CCNc2nc3ccc(OC)cc3s2)cc1.CCC |
| InChI | InChI=1S/C22H24N4O3S2.C3H8/c1-14(27)3-10-20(28)31-21(23)25-16-6-4-15(5-7-16)11-12-24-22-26-18-9-8-17(29-2)13-19(18)30-22;1-3-2/h4-9,13,27H,1,3,10-12H2,2H3,(H2,23,25)(H,24,26);3H2,1-2H3 |
| InChIKey | JPPNQERQMVJHCT-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|