C24H29N3O2S2 — CID 143137343
S-[N-[4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]ethyl]phenyl]-C-methylcarbonimidoyl] 4-methylpentanethioate (PubChem CID 143137343) has the molecular formula C24H29N3O2S2 and a molecular weight of 455.65 g/mol. Its IUPAC name is S-[N-[4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]ethyl]phenyl]-C-methylcarbonimidoyl] 4-methylpentanethioate.
| Compound Name | S-[N-[4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]ethyl]phenyl]-C-methylcarbonimidoyl] 4-methylpentanethioate |
|---|---|
| PubChem CID | 143137343 |
| Molecular Formula | C24H29N3O2S2 |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | S-[N-[4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]ethyl]phenyl]-C-methylcarbonimidoyl] 4-methylpentanethioate |
| SMILES | COc1ccc2nc(NCCc3ccc(/N=C(\C)SC(=O)CCC(C)C)cc3)sc2c1 |
| InChI | InChI=1S/C24H29N3O2S2/c1-16(2)5-12-23(28)30-17(3)26-19-8-6-18(7-9-19)13-14-25-24-27-21-11-10-20(29-4)15-22(21)31-24/h6-11,15-16H,5,12-14H2,1-4H3,(H,25,27)/b26-17+ |
| InChIKey | DYFPQQDMCYYNDG-YZSQISJMSA-N |
| XLogP | 6.71 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|