C12H23NO — CID 143140016
2,2-dimethyl-N-[(2E)-penta-2,4-dien-2-yl]propanamide;ethane (PubChem CID 143140016) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(2E)-penta-2,4-dien-2-yl]propanamide;ethane.
| Compound Name | 2,2-dimethyl-N-[(2E)-penta-2,4-dien-2-yl]propanamide;ethane |
|---|---|
| PubChem CID | 143140016 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2,2-dimethyl-N-[(2E)-penta-2,4-dien-2-yl]propanamide;ethane |
| SMILES | C=C/C=C(\C)NC(=O)C(C)(C)C.CC |
| InChI | InChI=1S/C10H17NO.C2H6/c1-6-7-8(2)11-9(12)10(3,4)5;1-2/h6-7H,1H2,2-5H3,(H,11,12);1-2H3/b8-7+; |
| InChIKey | JXXJQGOJHZJSSC-USRGLUTNSA-N |
| XLogP | 3.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|