C17H36N2 — CID 143147784
ethane;1-[(2E)-2-ethylpenta-2,4-dienyl]-N-methylpiperidin-4-amine (PubChem CID 143147784) has the molecular formula C17H36N2 and a molecular weight of 268.49 g/mol. Its IUPAC name is ethane;1-[(2E)-2-ethylpenta-2,4-dienyl]-N-methylpiperidin-4-amine.
| Compound Name | ethane;1-[(2E)-2-ethylpenta-2,4-dienyl]-N-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 143147784 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | ethane;1-[(2E)-2-ethylpenta-2,4-dienyl]-N-methylpiperidin-4-amine |
| SMILES | C=C/C=C(\CC)CN1CCC(NC)CC1.CC.CC |
| InChI | InChI=1S/C13H24N2.2C2H6/c1-4-6-12(5-2)11-15-9-7-13(14-3)8-10-15;2*1-2/h4,6,13-14H,1,5,7-11H2,2-3H3;2*1-2H3/b12-6+;; |
| InChIKey | ASNMPVGCUVPJDE-HTFHIHPASA-N |
| XLogP | 4.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|