C31H50O4 — CID 143150214
2-[(1R,3R,5E,7E,9R,10S,15S)-10-ethyl-3,7,15-trimethyl-12-methylidene-9-[[(6R)-6-methyloxan-2-yl]oxymethyl]-4-oxocyclohexadeca-5,7-dien-1-yl]acetaldehyde (PubChem CID 143150214) has the molecular formula C31H50O4 and a molecular weight of 486.74 g/mol. Its IUPAC name is 2-[(1R,3R,5E,7E,9R,10S,15S)-10-ethyl-3,7,15-trimethyl-12-methylidene-9-[[(6R)-6-methyloxan-2-yl]oxymethyl]-4-oxocyclohexadeca-5,7-dien-1-yl]acetaldehyde.
| Compound Name | 2-[(1R,3R,5E,7E,9R,10S,15S)-10-ethyl-3,7,15-trimethyl-12-methylidene-9-[[(6R)-6-methyloxan-2-yl]oxymethyl]-4-oxocyclohexadeca-5,7-dien-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 143150214 |
| Molecular Formula | C31H50O4 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | 2-[(1R,3R,5E,7E,9R,10S,15S)-10-ethyl-3,7,15-trimethyl-12-methylidene-9-[[(6R)-6-methyloxan-2-yl]oxymethyl]-4-oxocyclohexadeca-5,7-dien-1-yl]acetaldehyde |
| SMILES | C=C1CC[C@H](C)C[C@@H](CC=O)C[C@@H](C)C(=O)/C=C/C(C)=C/C(COC2CCC[C@@H](C)O2)[C@@H](CC)C1 |
| InChI | InChI=1S/C31H50O4/c1-7-28-18-23(3)12-11-22(2)17-27(15-16-32)20-25(5)30(33)14-13-24(4)19-29(28)21-34-31-10-8-9-26(6)35-31/h13-14,16,19,22,25-29,31H,3,7-12,15,17-18,20-21H2,1-2,4-6H3/b14-13+,24-19+/t22-,25+,26+,27+,28-,29?,31?/m0/s1 |
| InChIKey | OOGGLNGNADRFIM-YSXOKLIDSA-N |
| XLogP | 7.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|