C24H26FNO4 — CID 143151693
tert-butyl N-[2-fluoro-4-(7-methyl-4-oxo-2-propan-2-ylchromen-3-yl)phenyl]carbamate (PubChem CID 143151693) has the molecular formula C24H26FNO4 and a molecular weight of 411.47 g/mol. Its IUPAC name is tert-butyl N-[2-fluoro-4-(7-methyl-4-oxo-2-propan-2-ylchromen-3-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-fluoro-4-(7-methyl-4-oxo-2-propan-2-ylchromen-3-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 143151693 |
| Molecular Formula | C24H26FNO4 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | tert-butyl N-[2-fluoro-4-(7-methyl-4-oxo-2-propan-2-ylchromen-3-yl)phenyl]carbamate |
| SMILES | Cc1ccc2c(=O)c(-c3ccc(NC(=O)OC(C)(C)C)c(F)c3)c(C(C)C)oc2c1 |
| InChI | InChI=1S/C24H26FNO4/c1-13(2)22-20(21(27)16-9-7-14(3)11-19(16)29-22)15-8-10-18(17(25)12-15)26-23(28)30-24(4,5)6/h7-13H,1-6H3,(H,26,28) |
| InChIKey | KPMIMTZZBRLSFJ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |