C18H24FNO3 — CID 176886479
tert-butyl N-[2-fluoro-4-[4-(hydroxymethyl)cyclohexen-1-yl]phenyl]carbamate (PubChem CID 176886479) has the molecular formula C18H24FNO3 and a molecular weight of 321.39 g/mol. Its IUPAC name is tert-butyl N-[2-fluoro-4-[4-(hydroxymethyl)cyclohexen-1-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-fluoro-4-[4-(hydroxymethyl)cyclohexen-1-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 176886479 |
| Molecular Formula | C18H24FNO3 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | tert-butyl N-[2-fluoro-4-[4-(hydroxymethyl)cyclohexen-1-yl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C2=CCC(CO)CC2)cc1F |
| InChI | InChI=1S/C18H24FNO3/c1-18(2,3)23-17(22)20-16-9-8-14(10-15(16)19)13-6-4-12(11-21)5-7-13/h6,8-10,12,21H,4-5,7,11H2,1-3H3,(H,20,22) |
| InChIKey | SHOFKQVMZHEOQH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |