C21H21N5O2S — CID 143153557
N-[2-[[1-cyano-2-imino-2-(5-methoxy-1,3-benzothiazol-2-yl)ethyl]amino]propyl]benzamide (PubChem CID 143153557) has the molecular formula C21H21N5O2S and a molecular weight of 407.50 g/mol. Its IUPAC name is N-[2-[[1-cyano-2-imino-2-(5-methoxy-1,3-benzothiazol-2-yl)ethyl]amino]propyl]benzamide.
| Compound Name | N-[2-[[1-cyano-2-imino-2-(5-methoxy-1,3-benzothiazol-2-yl)ethyl]amino]propyl]benzamide |
|---|---|
| PubChem CID | 143153557 |
| Molecular Formula | C21H21N5O2S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N-[2-[[1-cyano-2-imino-2-(5-methoxy-1,3-benzothiazol-2-yl)ethyl]amino]propyl]benzamide |
| SMILES | [H]/N=C(/c1nc2cc(OC)ccc2s1)C(C#N)NC(C)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H21N5O2S/c1-13(12-24-20(27)14-6-4-3-5-7-14)25-17(11-22)19(23)21-26-16-10-15(28-2)8-9-18(16)29-21/h3-10,13,17,23,25H,12H2,1-2H3,(H,24,27)/b23-19+ |
| InChIKey | AHWHIWLXFLWPGS-FCDQGJHFSA-N |
| XLogP | 2.97 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|