C22H24F3N7O3 — CID 143161171
7-[4-[3-methyl-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-4-nitro-5-piperidin-1-yl-2,1,3-benzoxadiazole (PubChem CID 143161171) has the molecular formula C22H24F3N7O3 and a molecular weight of 491.47 g/mol. Its IUPAC name is 7-[4-[3-methyl-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-4-nitro-5-piperidin-1-yl-2,1,3-benzoxadiazole.
| Compound Name | 7-[4-[3-methyl-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-4-nitro-5-piperidin-1-yl-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 143161171 |
| Molecular Formula | C22H24F3N7O3 |
| Molecular Weight | 491.47 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 7-[4-[3-methyl-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-4-nitro-5-piperidin-1-yl-2,1,3-benzoxadiazole |
| SMILES | Cc1cc(C(F)(F)F)cnc1N1CCN(c2cc(N3CCCCC3)c([N+](=O)[O-])c3nonc23)CC1 |
| InChI | InChI=1S/C22H24F3N7O3/c1-14-11-15(22(23,24)25)13-26-21(14)31-9-7-30(8-10-31)16-12-17(29-5-3-2-4-6-29)20(32(33)34)19-18(16)27-35-28-19/h11-13H,2-10H2,1H3 |
| InChIKey | YQVIAAQGINPDBL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 104.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|