C23H25F9N6 — CID 143161420
2,3-diamino-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-1-[7-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1H-1-benzazepin-5-yl]guanidine (PubChem CID 143161420) has the molecular formula C23H25F9N6 and a molecular weight of 556.48 g/mol. Its IUPAC name is 2,3-diamino-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-1-[7-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1H-1-benzazepin-5-yl]guanidine.
| Compound Name | 2,3-diamino-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-1-[7-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1H-1-benzazepin-5-yl]guanidine |
|---|---|
| PubChem CID | 143161420 |
| Molecular Formula | C23H25F9N6 |
| Molecular Weight | 556.48 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 2,3-diamino-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-1-[7-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1H-1-benzazepin-5-yl]guanidine |
| SMILES | Cc1cc2c(cc1C(F)(F)F)NCCCC2N(CCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)/C(=N/N)NN |
| InChI | InChI=1S/C23H25F9N6/c1-12-7-16-18(11-17(12)23(30,31)32)35-5-2-3-19(16)38(20(36-33)37-34)6-4-13-8-14(21(24,25)26)10-15(9-13)22(27,28)29/h7-11,19,35H,2-6,33-34H2,1H3,(H,36,37) |
| InChIKey | FHCYRSXCWMVOLH-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 91.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|