C22H20 — CID 143163234
5-methyl-1,2-diphenyl-3-prop-1-en-2-ylbenzene (PubChem CID 143163234) has the molecular formula C22H20 and a molecular weight of 284.40 g/mol. Its IUPAC name is 5-methyl-1,2-diphenyl-3-prop-1-en-2-ylbenzene.
| Compound Name | 5-methyl-1,2-diphenyl-3-prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 143163234 |
| Molecular Formula | C22H20 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 5-methyl-1,2-diphenyl-3-prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1cc(C)cc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H20/c1-16(2)20-14-17(3)15-21(18-10-6-4-7-11-18)22(20)19-12-8-5-9-13-19/h4-15H,1H2,2-3H3 |
| InChIKey | HVJRVPHHNUATDC-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |