C28H29FN4O5 — CID 143163711
benzyl N-[4-[(3E)-5-cyano-3-ethylidene-2-[(E)-2-methyl-3-oxoprop-1-enyl]pyridazin-4-yl]oxy-3-fluorophenyl]carbamate;methoxyethane (PubChem CID 143163711) has the molecular formula C28H29FN4O5 and a molecular weight of 520.56 g/mol. Its IUPAC name is benzyl N-[4-[(3E)-5-cyano-3-ethylidene-2-[(E)-2-methyl-3-oxoprop-1-enyl]pyridazin-4-yl]oxy-3-fluorophenyl]carbamate;methoxyethane.
| Compound Name | benzyl N-[4-[(3E)-5-cyano-3-ethylidene-2-[(E)-2-methyl-3-oxoprop-1-enyl]pyridazin-4-yl]oxy-3-fluorophenyl]carbamate;methoxyethane |
|---|---|
| PubChem CID | 143163711 |
| Molecular Formula | C28H29FN4O5 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | benzyl N-[4-[(3E)-5-cyano-3-ethylidene-2-[(E)-2-methyl-3-oxoprop-1-enyl]pyridazin-4-yl]oxy-3-fluorophenyl]carbamate;methoxyethane |
| SMILES | C/C=C1\C(Oc2ccc(NC(=O)OCc3ccccc3)cc2F)=C(C#N)C=NN1/C=C(\C)C=O.CCOC |
| InChI | InChI=1S/C25H21FN4O4.C3H8O/c1-3-22-24(19(12-27)13-28-30(22)14-17(2)15-31)34-23-10-9-20(11-21(23)26)29-25(32)33-16-18-7-5-4-6-8-18;1-3-4-2/h3-11,13-15H,16H2,1-2H3,(H,29,32);3H2,1-2H3/b17-14+,22-3+; |
| InChIKey | FZNGXJRXWMDYGI-OSUVVUBHSA-N |
| XLogP | 5.69 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|