About ethane;2-ethylbutane-1-thiol
ethane;2-ethylbutane-1-thiol (PubChem CID 143165369) has the molecular formula C8H20S
and a molecular weight of 148.31 g/mol. Its IUPAC name is ethane;2-ethylbutane-1-thiol.
Molecular Properties
| Compound Name | ethane;2-ethylbutane-1-thiol |
| PubChem CID | 143165369 |
| Molecular Formula | C8H20S |
| Molecular Weight | 148.31 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | ethane;2-ethylbutane-1-thiol |
| SMILES | CC.CCC(CC)CS |
| InChI | InChI=1S/C6H14S.C2H6/c1-3-6(4-2)5-7;1-2/h6-7H,3-5H2,1-2H3;1-2H3 |
| InChIKey | FDLJIUHYJPKVCE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-ethylbutane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethylbutane-1-thiol?
The IUPAC name of ethane;2-ethylbutane-1-thiol (CID 143165369) is ethane;2-ethylbutane-1-thiol.
What is the SMILES notation for ethane;2-ethylbutane-1-thiol?
The canonical SMILES for ethane;2-ethylbutane-1-thiol is CC.CCC(CC)CS.
What is the InChIKey of ethane;2-ethylbutane-1-thiol?
The InChIKey is FDLJIUHYJPKVCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14S.C2H6/c1-3-6(4-2)5-7;1-2/h6-7H,3-5H2,1-2H3;1-2H3.
What are the key properties of ethane;2-ethylbutane-1-thiol?
ethane;2-ethylbutane-1-thiol has a molecular weight of 148.31 g/mol, XLogP of 3.38, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethylbutane-1-thiol is sourced from PubChem (CID 143165369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).