C13H19F9N2O5 — CID 143166081
1-[1,3-bis(2,2,2-trifluoroethoxy)-2-(2,2,2-trifluoroethoxymethyl)propan-2-yl]-3-(2-hydroxyethyl)urea (PubChem CID 143166081) has the molecular formula C13H19F9N2O5 and a molecular weight of 454.29 g/mol. Its IUPAC name is 1-[1,3-bis(2,2,2-trifluoroethoxy)-2-(2,2,2-trifluoroethoxymethyl)propan-2-yl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[1,3-bis(2,2,2-trifluoroethoxy)-2-(2,2,2-trifluoroethoxymethyl)propan-2-yl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 143166081 |
| Molecular Formula | C13H19F9N2O5 |
| Molecular Weight | 454.29 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 1-[1,3-bis(2,2,2-trifluoroethoxy)-2-(2,2,2-trifluoroethoxymethyl)propan-2-yl]-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)NC(COCC(F)(F)F)(COCC(F)(F)F)COCC(F)(F)F |
| InChI | InChI=1S/C13H19F9N2O5/c14-11(15,16)6-27-3-10(4-28-7-12(17,18)19,5-29-8-13(20,21)22)24-9(26)23-1-2-25/h25H,1-8H2,(H2,23,24,26) |
| InChIKey | QFUOEZGQHAZDEF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |